C15H17F2NO4 — CID 139293227
ethyl 2-[(1R,5S)-5-(3,5-difluorophenyl)-3-azabicyclo[3.1.0]hexan-2-yl]-2,2-dihydroxyacetate (PubChem CID 139293227) has the molecular formula C15H17F2NO4 and a molecular weight of 313.30 g/mol. Its IUPAC name is ethyl 2-[(1R,5S)-5-(3,5-difluorophenyl)-3-azabicyclo[3.1.0]hexan-2-yl]-2,2-dihydroxyacetate.
| Compound Name | ethyl 2-[(1R,5S)-5-(3,5-difluorophenyl)-3-azabicyclo[3.1.0]hexan-2-yl]-2,2-dihydroxyacetate |
|---|---|
| PubChem CID | 139293227 |
| Molecular Formula | C15H17F2NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl 2-[(1R,5S)-5-(3,5-difluorophenyl)-3-azabicyclo[3.1.0]hexan-2-yl]-2,2-dihydroxyacetate |
| SMILES | CCOC(=O)C(O)(O)C1NC[C@@]2(c3cc(F)cc(F)c3)C[C@@H]12 |
| InChI | InChI=1S/C15H17F2NO4/c1-2-22-13(19)15(20,21)12-11-6-14(11,7-18-12)8-3-9(16)5-10(17)4-8/h3-5,11-12,18,20-21H,2,6-7H2,1H3/t11-,12?,14+/m0/s1 |
| InChIKey | XQQGAFQMJYUWAP-HFUMIRBISA-N |
| XLogP | 0.44 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|