C18H16BrF2N3O3S — CID 139293314
2-[(6R)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-oxooxolan-3-yl)acetamide (PubChem CID 139293314) has the molecular formula C18H16BrF2N3O3S and a molecular weight of 472.31 g/mol. Its IUPAC name is 2-[(6R)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-oxooxolan-3-yl)acetamide.
| Compound Name | 2-[(6R)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-oxooxolan-3-yl)acetamide |
|---|---|
| PubChem CID | 139293314 |
| Molecular Formula | C18H16BrF2N3O3S |
| Molecular Weight | 472.31 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 2-[(6R)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-(2-oxooxolan-3-yl)acetamide |
| SMILES | O=C(Cc1[nH]c(=S)n2c1C[C@H](c1c(F)ccc(Br)c1F)C2)NC1CCOC1=O |
| InChI | InChI=1S/C18H16BrF2N3O3S/c19-9-1-2-10(20)15(16(9)21)8-5-13-12(23-18(28)24(13)7-8)6-14(25)22-11-3-4-27-17(11)26/h1-2,8,11H,3-7H2,(H,22,25)(H,23,28)/t8-,11?/m0/s1 |
| InChIKey | CMOIIPYTVXVSIB-YMNIQAILSA-N |
| XLogP | 2.90 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|