C18H19F4N3S — CID 139293318
(6R)-1-(2-pyrrolidin-1-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139293318) has the molecular formula C18H19F4N3S and a molecular weight of 385.43 g/mol. Its IUPAC name is (6R)-1-(2-pyrrolidin-1-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6R)-1-(2-pyrrolidin-1-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139293318 |
| Molecular Formula | C18H19F4N3S |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (6R)-1-(2-pyrrolidin-1-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Fc1cc(F)c(F)c([C@H]2Cc3c(CCN4CCCC4)[nH]c(=S)n3C2)c1F |
| InChI | InChI=1S/C18H19F4N3S/c19-11-8-12(20)17(22)15(16(11)21)10-7-14-13(23-18(26)25(14)9-10)3-6-24-4-1-2-5-24/h8,10H,1-7,9H2,(H,23,26)/t10-/m0/s1 |
| InChIKey | ZRGRBESRTDUUAB-JTQLQIEISA-N |
| XLogP | 4.08 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|