C16H15BrF2N2O2S — CID 139293370
ethyl 2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate (PubChem CID 139293370) has the molecular formula C16H15BrF2N2O2S and a molecular weight of 417.28 g/mol. Its IUPAC name is ethyl 2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate.
| Compound Name | ethyl 2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate |
|---|---|
| PubChem CID | 139293370 |
| Molecular Formula | C16H15BrF2N2O2S |
| Molecular Weight | 417.28 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | ethyl 2-[(6S)-6-(3-bromo-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]acetate |
| SMILES | CCOC(=O)Cc1[nH]c(=S)n2c1C[C@@H](c1c(F)ccc(Br)c1F)C2 |
| InChI | InChI=1S/C16H15BrF2N2O2S/c1-2-23-13(22)6-11-12-5-8(7-21(12)16(24)20-11)14-10(18)4-3-9(17)15(14)19/h3-4,8H,2,5-7H2,1H3,(H,20,24)/t8-/m1/s1 |
| InChIKey | PQXSGBYKWDXUNL-MRVPVSSYSA-N |
| XLogP | 4.03 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|