C19H21F4N3OS — CID 139293382
(6R)-2-methyl-1-(2-morpholin-4-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139293382) has the molecular formula C19H21F4N3OS and a molecular weight of 415.46 g/mol. Its IUPAC name is (6R)-2-methyl-1-(2-morpholin-4-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6R)-2-methyl-1-(2-morpholin-4-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139293382 |
| Molecular Formula | C19H21F4N3OS |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (6R)-2-methyl-1-(2-morpholin-4-ylethyl)-6-(2,3,5,6-tetrafluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Cn1c(CCN2CCOCC2)c2n(c1=S)C[C@@H](c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C19H21F4N3OS/c1-24-14(2-3-25-4-6-27-7-5-25)15-8-11(10-26(15)19(24)28)16-17(22)12(20)9-13(21)18(16)23/h9,11H,2-8,10H2,1H3/t11-/m0/s1 |
| InChIKey | RZVVWGKMQFSJQH-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 22.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|