C22H28BrF2N3S — CID 139293423
(6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139293423) has the molecular formula C22H28BrF2N3S and a molecular weight of 484.45 g/mol. Its IUPAC name is (6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139293423 |
| Molecular Formula | C22H28BrF2N3S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | (6R)-6-(3-bromo-2,6-difluorophenyl)-1-[2-[[(1R)-1-cyclohexylethyl]amino]ethyl]-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | C[C@@H](NCCc1[nH]c(=S)n2c1C[C@H](c1c(F)ccc(Br)c1F)C2)C1CCCCC1 |
| InChI | InChI=1S/C22H28BrF2N3S/c1-13(14-5-3-2-4-6-14)26-10-9-18-19-11-15(12-28(19)22(29)27-18)20-17(24)8-7-16(23)21(20)25/h7-8,13-15,26H,2-6,9-12H2,1H3,(H,27,29)/t13-,15+/m1/s1 |
| InChIKey | VQLNTFNENLDVHC-HIFRSBDPSA-N |
| XLogP | 6.03 |
| TPSA | 32.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|