C19H22BrF2N3OS — CID 139293433
(6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139293433) has the molecular formula C19H22BrF2N3OS and a molecular weight of 458.37 g/mol. Its IUPAC name is (6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139293433 |
| Molecular Formula | C19H22BrF2N3OS |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (6S)-6-(3-bromo-2,6-difluorophenyl)-2-methyl-1-[2-[[(3R)-oxolan-3-yl]amino]ethyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Cn1c(CCN[C@@H]2CCOC2)c2n(c1=S)C[C@H](c1c(F)ccc(Br)c1F)C2 |
| InChI | InChI=1S/C19H22BrF2N3OS/c1-24-15(4-6-23-12-5-7-26-10-12)16-8-11(9-25(16)19(24)27)17-14(21)3-2-13(20)18(17)22/h2-3,11-12,23H,4-10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | LVLCGOPFTYYDBR-VXGBXAGGSA-N |
| XLogP | 3.86 |
| TPSA | 31.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|