C20H22ClF2N3O2S — CID 139293555
2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-methyl-N-(oxan-4-yl)acetamide (PubChem CID 139293555) has the molecular formula C20H22ClF2N3O2S and a molecular weight of 441.93 g/mol. Its IUPAC name is 2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-methyl-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-methyl-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 139293555 |
| Molecular Formula | C20H22ClF2N3O2S |
| Molecular Weight | 441.93 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-[(6S)-6-(3-chloro-2,6-difluorophenyl)-3-sulfanylidene-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]-N-methyl-N-(oxan-4-yl)acetamide |
| SMILES | CN(C(=O)Cc1[nH]c(=S)n2c1C[C@@H](c1c(F)ccc(Cl)c1F)C2)C1CCOCC1 |
| InChI | InChI=1S/C20H22ClF2N3O2S/c1-25(12-4-6-28-7-5-12)17(27)9-15-16-8-11(10-26(16)20(29)24-15)18-14(22)3-2-13(21)19(18)23/h2-3,11-12H,4-10H2,1H3,(H,24,29)/t11-/m1/s1 |
| InChIKey | IORNQDBAIIPLNO-LLVKDONJSA-N |
| XLogP | 4.00 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.93 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|