C17H34NP — CID 139293772
3,4,4,7-tetramethyl-N-(3-phosphanylbut-3-enyl)non-1-en-2-amine (PubChem CID 139293772) has the molecular formula C17H34NP and a molecular weight of 283.44 g/mol. Its IUPAC name is 3,4,4,7-tetramethyl-N-(3-phosphanylbut-3-enyl)non-1-en-2-amine.
| Compound Name | 3,4,4,7-tetramethyl-N-(3-phosphanylbut-3-enyl)non-1-en-2-amine |
|---|---|
| PubChem CID | 139293772 |
| Molecular Formula | C17H34NP |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | 3,4,4,7-tetramethyl-N-(3-phosphanylbut-3-enyl)non-1-en-2-amine |
| SMILES | C=C(P)CCNC(=C)C(C)C(C)(C)CCC(C)CC |
| InChI | InChI=1S/C17H34NP/c1-8-13(2)9-11-17(6,7)15(4)16(5)18-12-10-14(3)19/h13,15,18H,3,5,8-12,19H2,1-2,4,6-7H3 |
| InChIKey | FJSVEFVHROWICK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|