About ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate
ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate (PubChem CID 139293918) has the molecular formula C13H13F2NO3
and a molecular weight of 269.25 g/mol. Its IUPAC name is ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate |
| PubChem CID | 139293918 |
| Molecular Formula | C13H13F2NO3 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)NC[C@@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H13F2NO3/c1-2-19-13(18)11-10(6-16-12(11)17)7-3-8(14)5-9(15)4-7/h3-5,10-11H,2,6H2,1H3,(H,16,17)/t10-,11?/m1/s1 |
| InChIKey | GCJBUAGBDRHNEP-NFJWQWPMSA-N |
| XLogP | 1.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate?
The IUPAC name of ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate (CID 139293918) is ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate.
What is the SMILES notation for ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate?
The canonical SMILES for ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate is CCOC(=O)C1C(=O)NC[C@@H]1c1cc(F)cc(F)c1.
What is the InChIKey of ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate?
The InChIKey is GCJBUAGBDRHNEP-NFJWQWPMSA-N. The full InChI is InChI=1S/C13H13F2NO3/c1-2-19-13(18)11-10(6-16-12(11)17)7-3-8(14)5-9(15)4-7/h3-5,10-11H,2,6H2,1H3,(H,16,17)/t10-,11?/m1/s1.
What are the key properties of ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate?
ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate has a molecular weight of 269.25 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-4-(3,5-difluorophenyl)-2-oxopyrrolidine-3-carboxylate is sourced from PubChem (CID 139293918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).