C15H23N — CID 139294195
(3Z,5Z)-N-methyl-2-methylidene-5-(2-methylpropyl)nona-3,5,8-trien-1-imine (PubChem CID 139294195) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (3Z,5Z)-N-methyl-2-methylidene-5-(2-methylpropyl)nona-3,5,8-trien-1-imine.
| Compound Name | (3Z,5Z)-N-methyl-2-methylidene-5-(2-methylpropyl)nona-3,5,8-trien-1-imine |
|---|---|
| PubChem CID | 139294195 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (3Z,5Z)-N-methyl-2-methylidene-5-(2-methylpropyl)nona-3,5,8-trien-1-imine |
| SMILES | C=CC/C=C(\C=C/C(=C)/C=N/C)CC(C)C |
| InChI | InChI=1S/C15H23N/c1-6-7-8-15(11-13(2)3)10-9-14(4)12-16-5/h6,8-10,12-13H,1,4,7,11H2,2-3,5H3/b10-9-,15-8+,16-12+ |
| InChIKey | CVRLWXHAOUQODV-ZGDKCSANSA-N |
| XLogP | 4.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|