C21H26F3N3OS — CID 139294255
(6R)-2-methyl-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139294255) has the molecular formula C21H26F3N3OS and a molecular weight of 425.52 g/mol. Its IUPAC name is (6R)-2-methyl-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6R)-2-methyl-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139294255 |
| Molecular Formula | C21H26F3N3OS |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (6R)-2-methyl-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Cn1c(CCNCC2CCOCC2)c2n(c1=S)C[C@@H](c1c(F)ccc(F)c1F)C2 |
| InChI | InChI=1S/C21H26F3N3OS/c1-26-17(4-7-25-11-13-5-8-28-9-6-13)18-10-14(12-27(18)21(26)29)19-15(22)2-3-16(23)20(19)24/h2-3,13-14,25H,4-12H2,1H3/t14-/m0/s1 |
| InChIKey | PTDOHPJBDBWVIV-AWEZNQCLSA-N |
| XLogP | 3.87 |
| TPSA | 31.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|