C29H37NO2 — CID 139294288
(11R)-15-isoquinolin-7-yl-6-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadec-2-en-11-ol (PubChem CID 139294288) has the molecular formula C29H37NO2 and a molecular weight of 431.62 g/mol. Its IUPAC name is (11R)-15-isoquinolin-7-yl-6-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadec-2-en-11-ol.
| Compound Name | (11R)-15-isoquinolin-7-yl-6-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadec-2-en-11-ol |
|---|---|
| PubChem CID | 139294288 |
| Molecular Formula | C29H37NO2 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | (11R)-15-isoquinolin-7-yl-6-methoxy-16-methyltetracyclo[9.7.0.03,8.012,16]octadec-2-en-11-ol |
| SMILES | COC1CCC2=CC3CCC4(C)C(c5ccc6ccncc6c5)CCC4[C@@]3(O)CCC2C1 |
| InChI | InChI=1S/C29H37NO2/c1-28-12-10-24-16-20-5-6-25(32-2)17-21(20)9-13-29(24,31)27(28)8-7-26(28)22-4-3-19-11-14-30-18-23(19)15-22/h3-4,11,14-16,18,21,24-27,31H,5-10,12-13,17H2,1-2H3/t21?,24?,25?,26?,27?,28?,29-/m1/s1 |
| InChIKey | RLKDKIFNKJSRKQ-DZXKHGARSA-N |
| XLogP | 6.41 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|