C15H12F4N2O2S — CID 139294538
3-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propanoic acid (PubChem CID 139294538) has the molecular formula C15H12F4N2O2S and a molecular weight of 360.33 g/mol. Its IUPAC name is 3-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propanoic acid.
| Compound Name | 3-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 139294538 |
| Molecular Formula | C15H12F4N2O2S |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 3-[(6R)-3-sulfanylidene-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCc1[nH]c(=S)n2c1C[C@H](c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C15H12F4N2O2S/c16-7-4-8(17)14(19)12(13(7)18)6-3-10-9(1-2-11(22)23)20-15(24)21(10)5-6/h4,6H,1-3,5H2,(H,20,24)(H,22,23)/t6-/m0/s1 |
| InChIKey | SGEDTXBAHUVVGZ-LURJTMIESA-N |
| XLogP | 3.46 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|