C17H17F4N3OS — CID 139294555
1-(morpholin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139294555) has the molecular formula C17H17F4N3OS and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-(morpholin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | 1-(morpholin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139294555 |
| Molecular Formula | C17H17F4N3OS |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-(morpholin-4-ylmethyl)-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Fc1cc(F)c(F)c(C2Cc3c(CN4CCOCC4)[nH]c(=S)n3C2)c1F |
| InChI | InChI=1S/C17H17F4N3OS/c18-10-6-11(19)16(21)14(15(10)20)9-5-13-12(22-17(26)24(13)7-9)8-23-1-3-25-4-2-23/h6,9H,1-5,7-8H2,(H,22,26) |
| InChIKey | GDQALHMQQKRIAR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|