C29H36N2O — CID 139294723
(1S,2R,5S,14R,16R)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-8-en-14-amine (PubChem CID 139294723) has the molecular formula C29H36N2O and a molecular weight of 428.62 g/mol. Its IUPAC name is (1S,2R,5S,14R,16R)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-8-en-14-amine.
| Compound Name | (1S,2R,5S,14R,16R)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-8-en-14-amine |
|---|---|
| PubChem CID | 139294723 |
| Molecular Formula | C29H36N2O |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (1S,2R,5S,14R,16R)-5-isoquinolin-7-yl-N,6-dimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadec-8-en-14-amine |
| SMILES | CN[C@@H]1CCC2CC3=CCC4(C)[C@@H](c5ccc6ccncc6c5)CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C29H36N2O/c1-27-11-9-23-16-22-5-6-24(30-2)17-28(22)12-13-29(23,32-28)26(27)8-7-25(27)20-4-3-19-10-14-31-18-21(19)15-20/h3-4,9-10,14-15,18,22,24-26,30H,5-8,11-13,16-17H2,1-2H3/t22?,24-,25-,26-,27?,28-,29-/m1/s1 |
| InChIKey | UYYZQGMDSXYUNY-RDWKTTEJSA-N |
| XLogP | 6.14 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|