C10H12ClN5 — CID 139295630
8-chloro-3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 139295630) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 8-chloro-3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-chloro-3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 139295630 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 8-chloro-3-piperidin-1-yl-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Clc1nccn2c(N3CCCCC3)nnc12 |
| InChI | InChI=1S/C10H12ClN5/c11-8-9-13-14-10(16(9)7-4-12-8)15-5-2-1-3-6-15/h4,7H,1-3,5-6H2 |
| InChIKey | LXZYXHGHBNGIBE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |