About 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine
6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine (PubChem CID 139295670) has the molecular formula C10H13ClF2N4
and a molecular weight of 262.69 g/mol. Its IUPAC name is 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine |
| PubChem CID | 139295670 |
| Molecular Formula | C10H13ClF2N4 |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine |
| SMILES | Nc1c(Cl)ncnc1N[C@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C10H13ClF2N4/c11-8-7(14)9(16-5-15-8)17-6-2-1-3-10(12,13)4-6/h5-6H,1-4,14H2,(H,15,16,17)/t6-/m0/s1 |
| InChIKey | BRISZNAJSPRUAC-LURJTMIESA-N |
| XLogP | 2.70 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine?
The IUPAC name of 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine (CID 139295670) is 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine.
What is the SMILES notation for 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine?
The canonical SMILES for 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine is Nc1c(Cl)ncnc1N[C@H]1CCCC(F)(F)C1.
What is the InChIKey of 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine?
The InChIKey is BRISZNAJSPRUAC-LURJTMIESA-N. The full InChI is InChI=1S/C10H13ClF2N4/c11-8-7(14)9(16-5-15-8)17-6-2-1-3-10(12,13)4-6/h5-6H,1-4,14H2,(H,15,16,17)/t6-/m0/s1.
What are the key properties of 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine?
6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine has a molecular weight of 262.69 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-N-[(1S)-3,3-difluorocyclohexyl]pyrimidine-4,5-diamine is sourced from PubChem (CID 139295670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).