C10H14N6 — CID 139295708
3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 139295708) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | 3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 139295708 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 3-piperidin-2-yl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | Nc1nccn2c(C3CCCCN3)nnc12 |
| InChI | InChI=1S/C10H14N6/c11-8-10-15-14-9(16(10)6-5-13-8)7-3-1-2-4-12-7/h5-7,12H,1-4H2,(H2,11,13) |
| InChIKey | VYJAIEACFNZGGP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |