About 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate
4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate (PubChem CID 139295717) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate |
| PubChem CID | 139295717 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate |
| SMILES | CC(C)(C)C1(C(=O)OCCCCN)CCC1 |
| InChI | InChI=1S/C13H25NO2/c1-12(2,3)13(7-6-8-13)11(15)16-10-5-4-9-14/h4-10,14H2,1-3H3 |
| InChIKey | FKJKWIKJBXJBOY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate?
The IUPAC name of 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate (CID 139295717) is 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate.
What is the SMILES notation for 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate?
The canonical SMILES for 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate is CC(C)(C)C1(C(=O)OCCCCN)CCC1.
What is the InChIKey of 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate?
The InChIKey is FKJKWIKJBXJBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-12(2,3)13(7-6-8-13)11(15)16-10-5-4-9-14/h4-10,14H2,1-3H3.
What are the key properties of 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate?
4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate has a molecular weight of 227.35 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobutyl 1-tert-butylcyclobutane-1-carboxylate is sourced from PubChem (CID 139295717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).