C23H18ClF2N3O2 — CID 139296000
N-(4-chloro-2-fluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-2,3,6,7-tetrahydroazepin-1-yl]-2-oxoacetamide (PubChem CID 139296000) has the molecular formula C23H18ClF2N3O2 and a molecular weight of 441.87 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-2,3,6,7-tetrahydroazepin-1-yl]-2-oxoacetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-2,3,6,7-tetrahydroazepin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 139296000 |
| Molecular Formula | C23H18ClF2N3O2 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[4-(6-fluoroquinolin-4-yl)-2,3,6,7-tetrahydroazepin-1-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1F)C(=O)N1CCC=C(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C23H18ClF2N3O2/c24-15-3-5-21(19(26)12-15)28-22(30)23(31)29-10-1-2-14(8-11-29)17-7-9-27-20-6-4-16(25)13-18(17)20/h2-7,9,12-13H,1,8,10-11H2,(H,28,30) |
| InChIKey | IGYGTIAFIHLGOW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|