About 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde
2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde (PubChem CID 139296092) has the molecular formula C15H14F3NO3
and a molecular weight of 313.27 g/mol. Its IUPAC name is 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde |
| PubChem CID | 139296092 |
| Molecular Formula | C15H14F3NO3 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde |
| SMILES | O=CC(=O)N1CCC2(CC1)COc1cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C15H14F3NO3/c16-15(17,18)10-1-2-11-12(7-10)22-9-14(11)3-5-19(6-4-14)13(21)8-20/h1-2,7-8H,3-6,9H2 |
| InChIKey | OCFJLSCRHBMQHS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde?
The IUPAC name of 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde (CID 139296092) is 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde.
What is the SMILES notation for 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde?
The canonical SMILES for 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde is O=CC(=O)N1CCC2(CC1)COc1cc(C(F)(F)F)ccc12.
What is the InChIKey of 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde?
The InChIKey is OCFJLSCRHBMQHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3NO3/c16-15(17,18)10-1-2-11-12(7-10)22-9-14(11)3-5-19(6-4-14)13(21)8-20/h1-2,7-8H,3-6,9H2.
What are the key properties of 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde?
2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde has a molecular weight of 313.27 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-[6-(trifluoromethyl)spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]acetaldehyde is sourced from PubChem (CID 139296092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).