C30H34N4 — CID 139296469
4-[5-(2-tert-butylphenyl)-2-(2,6-dimethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline (PubChem CID 139296469) has the molecular formula C30H34N4 and a molecular weight of 450.63 g/mol. Its IUPAC name is 4-[5-(2-tert-butylphenyl)-2-(2,6-dimethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline.
| Compound Name | 4-[5-(2-tert-butylphenyl)-2-(2,6-dimethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline |
|---|---|
| PubChem CID | 139296469 |
| Molecular Formula | C30H34N4 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 4-[5-(2-tert-butylphenyl)-2-(2,6-dimethylphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]aniline |
| SMILES | Cc1cccc(C)c1-n1nc2c(c1-c1ccc(N)cc1)CN(c1ccccc1C(C)(C)C)CC2 |
| InChI | InChI=1S/C30H34N4/c1-20-9-8-10-21(2)28(20)34-29(22-13-15-23(31)16-14-22)24-19-33(18-17-26(24)32-34)27-12-7-6-11-25(27)30(3,4)5/h6-16H,17-19,31H2,1-5H3 |
| InChIKey | VSNWYSRGRUFEPN-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|