C21H31IO8 — CID 139296654
methyl 2-[(1S,9R)-4,8-dihydroxy-5-(7-iodo-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate (PubChem CID 139296654) has the molecular formula C21H31IO8 and a molecular weight of 538.38 g/mol. Its IUPAC name is methyl 2-[(1S,9R)-4,8-dihydroxy-5-(7-iodo-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate.
| Compound Name | methyl 2-[(1S,9R)-4,8-dihydroxy-5-(7-iodo-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
|---|---|
| PubChem CID | 139296654 |
| Molecular Formula | C21H31IO8 |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | methyl 2-[(1S,9R)-4,8-dihydroxy-5-(7-iodo-2-oxooct-7-enyl)-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
| SMILES | C=C(I)CCCCC(=O)CC1OC2C(O[C@H]3CCC(CC(=O)OC)O[C@@H]3C2O)C1O |
| InChI | InChI=1S/C21H31IO8/c1-11(22)5-3-4-6-12(23)9-15-17(25)20-21(30-15)18(26)19-14(29-20)8-7-13(28-19)10-16(24)27-2/h13-15,17-21,25-26H,1,3-10H2,2H3/t13?,14-,15?,17?,18?,19-,20?,21?/m0/s1 |
| InChIKey | JMRWRBXYPSXJOW-PXUWKMGLSA-N |
| XLogP | 1.82 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|