C28H34F3N5O — CID 139296881
[4-[2-(2,6-diethylphenyl)-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea (PubChem CID 139296881) has the molecular formula C28H34F3N5O and a molecular weight of 513.61 g/mol. Its IUPAC name is [4-[2-(2,6-diethylphenyl)-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea.
| Compound Name | [4-[2-(2,6-diethylphenyl)-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 139296881 |
| Molecular Formula | C28H34F3N5O |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | [4-[2-(2,6-diethylphenyl)-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea |
| SMILES | CCc1cccc(CC)c1-n1nc2c(c1-c1ccc(NC(N)=O)cc1)CN(CC(C)(C)C(F)(F)F)CC2 |
| InChI | InChI=1S/C28H34F3N5O/c1-5-18-8-7-9-19(6-2)24(18)36-25(20-10-12-21(13-11-20)33-26(32)37)22-16-35(15-14-23(22)34-36)17-27(3,4)28(29,30)31/h7-13H,5-6,14-17H2,1-4H3,(H3,32,33,37) |
| InChIKey | MJZSSSKGHZOURG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |