C29H36F3N5O2 — CID 139296904
[4-[2-[2-methyl-6-(2-methylpropoxy)phenyl]-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea (PubChem CID 139296904) has the molecular formula C29H36F3N5O2 and a molecular weight of 543.63 g/mol. Its IUPAC name is [4-[2-[2-methyl-6-(2-methylpropoxy)phenyl]-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea.
| Compound Name | [4-[2-[2-methyl-6-(2-methylpropoxy)phenyl]-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 139296904 |
| Molecular Formula | C29H36F3N5O2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | [4-[2-[2-methyl-6-(2-methylpropoxy)phenyl]-5-(3,3,3-trifluoro-2,2-dimethylpropyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-yl]phenyl]urea |
| SMILES | Cc1cccc(OCC(C)C)c1-n1nc2c(c1-c1ccc(NC(N)=O)cc1)CN(CC(C)(C)C(F)(F)F)CC2 |
| InChI | InChI=1S/C29H36F3N5O2/c1-18(2)16-39-24-8-6-7-19(3)25(24)37-26(20-9-11-21(12-10-20)34-27(33)38)22-15-36(14-13-23(22)35-37)17-28(4,5)29(30,31)32/h6-12,18H,13-17H2,1-5H3,(H3,33,34,38) |
| InChIKey | CBLMVICDXXYVNN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |