C22H33IO8 — CID 139296932
methyl 2-[(1S,9R)-4,8-dihydroxy-5-[(5R)-7-iodo-5-methyl-2-oxooct-7-enyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate (PubChem CID 139296932) has the molecular formula C22H33IO8 and a molecular weight of 552.40 g/mol. Its IUPAC name is methyl 2-[(1S,9R)-4,8-dihydroxy-5-[(5R)-7-iodo-5-methyl-2-oxooct-7-enyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate.
| Compound Name | methyl 2-[(1S,9R)-4,8-dihydroxy-5-[(5R)-7-iodo-5-methyl-2-oxooct-7-enyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
|---|---|
| PubChem CID | 139296932 |
| Molecular Formula | C22H33IO8 |
| Molecular Weight | 552.40 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | methyl 2-[(1S,9R)-4,8-dihydroxy-5-[(5R)-7-iodo-5-methyl-2-oxooct-7-enyl]-2,6,10-trioxatricyclo[7.4.0.03,7]tridecan-11-yl]acetate |
| SMILES | C=C(I)C[C@H](C)CCC(=O)CC1OC2C(O[C@H]3CCC(CC(=O)OC)O[C@@H]3C2O)C1O |
| InChI | InChI=1S/C22H33IO8/c1-11(8-12(2)23)4-5-13(24)9-16-18(26)21-22(31-16)19(27)20-15(30-21)7-6-14(29-20)10-17(25)28-3/h11,14-16,18-22,26-27H,2,4-10H2,1,3H3/t11-,14?,15+,16?,18?,19?,20+,21?,22?/m1/s1 |
| InChIKey | ACEOJIOTAXKPAG-SBSRDBQOSA-N |
| XLogP | 2.07 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|