C46H45FN2O — CID 139297221
N-(9,9-dimethyl-1,4b,5,6,7,9a-hexahydrofluoren-4-yl)-9-(4-fluorophenyl)-N-(3-methyl-3,4,5a,9a-tetrahydrodibenzofuran-1-yl)-4a,9a-dihydrocarbazol-3-amine (PubChem CID 139297221) has the molecular formula C46H45FN2O and a molecular weight of 660.88 g/mol. Its IUPAC name is N-(9,9-dimethyl-1,4b,5,6,7,9a-hexahydrofluoren-4-yl)-9-(4-fluorophenyl)-N-(3-methyl-3,4,5a,9a-tetrahydrodibenzofuran-1-yl)-4a,9a-dihydrocarbazol-3-amine.
| Compound Name | N-(9,9-dimethyl-1,4b,5,6,7,9a-hexahydrofluoren-4-yl)-9-(4-fluorophenyl)-N-(3-methyl-3,4,5a,9a-tetrahydrodibenzofuran-1-yl)-4a,9a-dihydrocarbazol-3-amine |
|---|---|
| PubChem CID | 139297221 |
| Molecular Formula | C46H45FN2O |
| Molecular Weight | 660.88 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | N-(9,9-dimethyl-1,4b,5,6,7,9a-hexahydrofluoren-4-yl)-9-(4-fluorophenyl)-N-(3-methyl-3,4,5a,9a-tetrahydrodibenzofuran-1-yl)-4a,9a-dihydrocarbazol-3-amine |
| SMILES | CC1C=C(N(C2=CC3c4ccccc4N(c4ccc(F)cc4)C3C=C2)C2=C3C4CCCC=C4C(C)(C)C3CC=C2)C2=C(C1)OC1C=CC=CC21 |
| InChI | InChI=1S/C46H45FN2O/c1-28-25-41(45-34-13-6-9-18-42(34)50-43(45)26-28)49(40-17-10-15-37-44(40)33-12-4-7-14-36(33)46(37,2)3)31-23-24-39-35(27-31)32-11-5-8-16-38(32)48(39)30-21-19-29(47)20-22-30/h5-6,8-11,13-14,16-25,27-28,33-35,37,39,42H,4,7,12,15,26H2,1-3H3 |
| InChIKey | VESSWXNKHYFTEG-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.88 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|