C44H84N2 — CID 139297433
4-N-[(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl]-1-N,1-N-dimethylpent-4-ene-1,4-diamine (PubChem CID 139297433) has the molecular formula C44H84N2 and a molecular weight of 641.17 g/mol. Its IUPAC name is 4-N-[(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl]-1-N,1-N-dimethylpent-4-ene-1,4-diamine.
| Compound Name | 4-N-[(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl]-1-N,1-N-dimethylpent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 139297433 |
| Molecular Formula | C44H84N2 |
| Molecular Weight | 641.17 g/mol |
| Exact Mass | 640.66 |
| IUPAC Name | 4-N-[(6Z,9Z,28Z)-heptatriaconta-6,9,28-trien-19-yl]-1-N,1-N-dimethylpent-4-ene-1,4-diamine |
| SMILES | C=C(CCCN(C)C)NC(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C44H84N2/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-40-44(45-43(3)39-38-42-46(4)5)41-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14,16,20-23,44-45H,3,6-13,15,17-19,24-42H2,1-2,4-5H3/b16-14-,22-20-,23-21- |
| InChIKey | FVTARGMMCMODCZ-UQNIBARNSA-N |
| XLogP | 14.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.17 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|