C18H27FO2 — CID 139297596
(6R,8R,10R,13S)-6-fluoro-3-hydroxy-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 139297596) has the molecular formula C18H27FO2 and a molecular weight of 294.41 g/mol. Its IUPAC name is (6R,8R,10R,13S)-6-fluoro-3-hydroxy-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (6R,8R,10R,13S)-6-fluoro-3-hydroxy-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 139297596 |
| Molecular Formula | C18H27FO2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (6R,8R,10R,13S)-6-fluoro-3-hydroxy-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC3[C@H]4CCC(O)CC4[C@H](F)C[C@H]3C1CCC2=O |
| InChI | InChI=1S/C18H27FO2/c1-18-7-6-12-11-3-2-10(20)8-14(11)16(19)9-13(12)15(18)4-5-17(18)21/h10-16,20H,2-9H2,1H3/t10?,11-,12?,13-,14?,15?,16-,18+/m1/s1 |
| InChIKey | XHEZGKZYEYZGEB-GPOIGVFWSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |