C27H25F6IN4O — CID 139298129
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(4-iodopiperazin-1-yl)-N-methyl-4-(2-methylphenyl)pyridine-3-carboxamide (PubChem CID 139298129) has the molecular formula C27H25F6IN4O and a molecular weight of 662.42 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(4-iodopiperazin-1-yl)-N-methyl-4-(2-methylphenyl)pyridine-3-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(4-iodopiperazin-1-yl)-N-methyl-4-(2-methylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139298129 |
| Molecular Formula | C27H25F6IN4O |
| Molecular Weight | 662.42 g/mol |
| Exact Mass | 662.10 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-6-(4-iodopiperazin-1-yl)-N-methyl-4-(2-methylphenyl)pyridine-3-carboxamide |
| SMILES | Cc1ccccc1-c1cc(N2CCN(I)CC2)ncc1C(=O)N(C)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H25F6IN4O/c1-17-5-3-4-6-21(17)22-14-24(37-7-9-38(34)10-8-37)35-15-23(22)25(39)36(2)16-18-11-19(26(28,29)30)13-20(12-18)27(31,32)33/h3-6,11-15H,7-10,16H2,1-2H3 |
| InChIKey | RRHJSWSLPHZLPH-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.42 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|