C27H31N5OS — CID 139298916
3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]-N-propan-2-ylprop-2-yn-1-amine (PubChem CID 139298916) has the molecular formula C27H31N5OS and a molecular weight of 473.65 g/mol. Its IUPAC name is 3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]-N-propan-2-ylprop-2-yn-1-amine.
| Compound Name | 3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]-N-propan-2-ylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 139298916 |
| Molecular Formula | C27H31N5OS |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]-N-propan-2-ylprop-2-yn-1-amine |
| SMILES | Cc1cc(OCc2nnc(SC3C=CCCC3)n2-c2cccnc2)ccc1C#CCNC(C)C |
| InChI | InChI=1S/C27H31N5OS/c1-20(2)29-16-7-9-22-13-14-24(17-21(22)3)33-19-26-30-31-27(34-25-11-5-4-6-12-25)32(26)23-10-8-15-28-18-23/h5,8,10-11,13-15,17-18,20,25,29H,4,6,12,16,19H2,1-3H3 |
| InChIKey | FHKWWVGFMMYWHD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|