About 2-nonan-3-yl-1H-pyrrole
2-nonan-3-yl-1H-pyrrole (PubChem CID 139299557) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is 2-nonan-3-yl-1H-pyrrole.
Molecular Properties
| Compound Name | 2-nonan-3-yl-1H-pyrrole |
| PubChem CID | 139299557 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 2-nonan-3-yl-1H-pyrrole |
| SMILES | CCCCCCC(CC)c1ccc[nH]1 |
| InChI | InChI=1S/C13H23N/c1-3-5-6-7-9-12(4-2)13-10-8-11-14-13/h8,10-12,14H,3-7,9H2,1-2H3 |
| InChIKey | URWOSFVOCTUFSA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-nonan-3-yl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonan-3-yl-1H-pyrrole?
The IUPAC name of 2-nonan-3-yl-1H-pyrrole (CID 139299557) is 2-nonan-3-yl-1H-pyrrole.
What is the SMILES notation for 2-nonan-3-yl-1H-pyrrole?
The canonical SMILES for 2-nonan-3-yl-1H-pyrrole is CCCCCCC(CC)c1ccc[nH]1.
What is the InChIKey of 2-nonan-3-yl-1H-pyrrole?
The InChIKey is URWOSFVOCTUFSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-3-5-6-7-9-12(4-2)13-10-8-11-14-13/h8,10-12,14H,3-7,9H2,1-2H3.
What are the key properties of 2-nonan-3-yl-1H-pyrrole?
2-nonan-3-yl-1H-pyrrole has a molecular weight of 193.33 g/mol, XLogP of 4.48, 7 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonan-3-yl-1H-pyrrole is sourced from PubChem (CID 139299557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).