C28H28FN5O — CID 139299815
2-[4-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3-fluorophenyl)quinolin-6-yl]-4-methylpyridin-3-amine (PubChem CID 139299815) has the molecular formula C28H28FN5O and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-[4-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3-fluorophenyl)quinolin-6-yl]-4-methylpyridin-3-amine.
| Compound Name | 2-[4-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3-fluorophenyl)quinolin-6-yl]-4-methylpyridin-3-amine |
|---|---|
| PubChem CID | 139299815 |
| Molecular Formula | C28H28FN5O |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[4-[(4aS,8aS)-1,2,3,4a,5,7,8,8a-octahydropyrido[3,4-b][1,4]oxazin-6-yl]-3-(3-fluorophenyl)quinolin-6-yl]-4-methylpyridin-3-amine |
| SMILES | Cc1ccnc(-c2ccc3ncc(-c4cccc(F)c4)c(N4CC[C@@H]5NCCO[C@H]5C4)c3c2)c1N |
| InChI | InChI=1S/C28H28FN5O/c1-17-7-9-32-27(26(17)30)19-5-6-23-21(14-19)28(22(15-33-23)18-3-2-4-20(29)13-18)34-11-8-24-25(16-34)35-12-10-31-24/h2-7,9,13-15,24-25,31H,8,10-12,16,30H2,1H3/t24-,25-/m0/s1 |
| InChIKey | YDJBVXHMFAVHOG-DQEYMECFSA-N |
| XLogP | 4.56 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |