About 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile
4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile (PubChem CID 139300054) has the molecular formula C11H11ClF2N4
and a molecular weight of 272.69 g/mol. Its IUPAC name is 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile.
Molecular Properties
| Compound Name | 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile |
| PubChem CID | 139300054 |
| Molecular Formula | C11H11ClF2N4 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile |
| SMILES | N#Cc1nc(Cl)cc(NC2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C11H11ClF2N4/c12-8-5-9(18-10(6-15)17-8)16-7-1-3-11(13,14)4-2-7/h5,7H,1-4H2,(H,16,17,18) |
| InChIKey | JAGGWGIDCKJNJF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile?
The IUPAC name of 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile (CID 139300054) is 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile.
What is the SMILES notation for 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile?
The canonical SMILES for 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile is N#Cc1nc(Cl)cc(NC2CCC(F)(F)CC2)n1.
What is the InChIKey of 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile?
The InChIKey is JAGGWGIDCKJNJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2N4/c12-8-5-9(18-10(6-15)17-8)16-7-1-3-11(13,14)4-2-7/h5,7H,1-4H2,(H,16,17,18).
What are the key properties of 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile?
4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile has a molecular weight of 272.69 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-[(4,4-difluorocyclohexyl)amino]pyrimidine-2-carbonitrile is sourced from PubChem (CID 139300054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).