C20H24F2N4O — CID 139300099
1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3,5-dimethylpyrazol-1-yl)-4-pyridinyl]but-3-yn-1-ol (PubChem CID 139300099) has the molecular formula C20H24F2N4O and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3,5-dimethylpyrazol-1-yl)-4-pyridinyl]but-3-yn-1-ol.
| Compound Name | 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3,5-dimethylpyrazol-1-yl)-4-pyridinyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 139300099 |
| Molecular Formula | C20H24F2N4O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3,5-dimethylpyrazol-1-yl)-4-pyridinyl]but-3-yn-1-ol |
| SMILES | C#CCC(O)c1cc(NC2CCC(F)(F)CC2)nc(-n2nc(C)cc2C)c1 |
| InChI | InChI=1S/C20H24F2N4O/c1-4-5-17(27)15-11-18(23-16-6-8-20(21,22)9-7-16)24-19(12-15)26-14(3)10-13(2)25-26/h1,10-12,16-17,27H,5-9H2,2-3H3,(H,23,24) |
| InChIKey | GYHZRPPBULEGJD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|