C19H24F2N4O2S — CID 139300111
N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-5-methoxy-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 139300111) has the molecular formula C19H24F2N4O2S and a molecular weight of 410.49 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-5-methoxy-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine.
| Compound Name | N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-5-methoxy-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 139300111 |
| Molecular Formula | C19H24F2N4O2S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-5-methoxy-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | C=C(OCC)c1nc(-c2nc(C)cs2)nc(NC2CCC(F)(F)CC2)c1OC |
| InChI | InChI=1S/C19H24F2N4O2S/c1-5-27-12(3)14-15(26-4)16(23-13-6-8-19(20,21)9-7-13)25-17(24-14)18-22-11(2)10-28-18/h10,13H,3,5-9H2,1-2,4H3,(H,23,24,25) |
| InChIKey | JMAVDIRFHVPUQB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|