About 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol
1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol (PubChem CID 139300122) has the molecular formula C17H23F2N5O
and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol.
Molecular Properties
| Compound Name | 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol |
| PubChem CID | 139300122 |
| Molecular Formula | C17H23F2N5O |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol |
| SMILES | CCC(O)c1ccn(-c2nc(C)cc(NC3CCC(F)(F)CC3)n2)n1 |
| InChI | InChI=1S/C17H23F2N5O/c1-3-14(25)13-6-9-24(23-13)16-20-11(2)10-15(22-16)21-12-4-7-17(18,19)8-5-12/h6,9-10,12,14,25H,3-5,7-8H2,1-2H3,(H,20,21,22) |
| InChIKey | LVEKUMKLNYFZSI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol?
The IUPAC name of 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol (CID 139300122) is 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol.
What is the SMILES notation for 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol?
The canonical SMILES for 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol is CCC(O)c1ccn(-c2nc(C)cc(NC3CCC(F)(F)CC3)n2)n1.
What is the InChIKey of 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol?
The InChIKey is LVEKUMKLNYFZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F2N5O/c1-3-14(25)13-6-9-24(23-13)16-20-11(2)10-15(22-16)21-12-4-7-17(18,19)8-5-12/h6,9-10,12,14,25H,3-5,7-8H2,1-2H3,(H,20,21,22).
What are the key properties of 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol?
1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol has a molecular weight of 351.40 g/mol, XLogP of 3.40, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazol-3-yl]propan-1-ol is sourced from PubChem (CID 139300122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).