About [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate
[6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate (PubChem CID 139300232) has the molecular formula C16H19F2N5O3
and a molecular weight of 367.36 g/mol. Its IUPAC name is [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate.
Molecular Properties
| Compound Name | [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate |
| PubChem CID | 139300232 |
| Molecular Formula | C16H19F2N5O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate |
| SMILES | Cc1ccn(-c2nc(NC3CCC(F)(F)CC3)cc(OC(=O)CO)n2)n1 |
| InChI | InChI=1S/C16H19F2N5O3/c1-10-4-7-23(22-10)15-20-12(8-13(21-15)26-14(25)9-24)19-11-2-5-16(17,18)6-3-11/h4,7-8,11,24H,2-3,5-6,9H2,1H3,(H,19,20,21) |
| InChIKey | ZODQRQKHWXGICE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate?
The IUPAC name of [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate (CID 139300232) is [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate.
What is the SMILES notation for [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate?
The canonical SMILES for [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate is Cc1ccn(-c2nc(NC3CCC(F)(F)CC3)cc(OC(=O)CO)n2)n1.
What is the InChIKey of [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate?
The InChIKey is ZODQRQKHWXGICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N5O3/c1-10-4-7-23(22-10)15-20-12(8-13(21-15)26-14(25)9-24)19-11-2-5-16(17,18)6-3-11/h4,7-8,11,24H,2-3,5-6,9H2,1H3,(H,19,20,21).
What are the key properties of [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate?
[6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate has a molecular weight of 367.36 g/mol, XLogP of 1.86, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(4,4-difluorocyclohexyl)amino]-2-(3-methylpyrazol-1-yl)pyrimidin-4-yl] 2-hydroxyacetate is sourced from PubChem (CID 139300232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).