About [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol
[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol (PubChem CID 139300261) has the molecular formula C15H19F2N5O
and a molecular weight of 323.35 g/mol. Its IUPAC name is [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol |
| PubChem CID | 139300261 |
| Molecular Formula | C15H19F2N5O |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol |
| SMILES | Cc1ccn(-c2cc(CO)nc(NC3CCC(F)(F)CC3)n2)n1 |
| InChI | InChI=1S/C15H19F2N5O/c1-10-4-7-22(21-10)13-8-12(9-23)19-14(20-13)18-11-2-5-15(16,17)6-3-11/h4,7-8,11,23H,2-3,5-6,9H2,1H3,(H,18,19,20) |
| InChIKey | FLSKJJSJHIDHKV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol?
The IUPAC name of [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol (CID 139300261) is [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol.
What is the SMILES notation for [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol?
The canonical SMILES for [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol is Cc1ccn(-c2cc(CO)nc(NC3CCC(F)(F)CC3)n2)n1.
What is the InChIKey of [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol?
The InChIKey is FLSKJJSJHIDHKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2N5O/c1-10-4-7-22(21-10)13-8-12(9-23)19-14(20-13)18-11-2-5-15(16,17)6-3-11/h4,7-8,11,23H,2-3,5-6,9H2,1H3,(H,18,19,20).
What are the key properties of [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol?
[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol has a molecular weight of 323.35 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)pyrimidin-4-yl]methanol is sourced from PubChem (CID 139300261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).