About [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol
[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol (PubChem CID 139300333) has the molecular formula C12H15ClF2N2O
and a molecular weight of 276.71 g/mol. Its IUPAC name is [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol.
Molecular Properties
| Compound Name | [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol |
| PubChem CID | 139300333 |
| Molecular Formula | C12H15ClF2N2O |
| Molecular Weight | 276.71 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol |
| SMILES | OCc1cc(Cl)nc(NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C12H15ClF2N2O/c13-10-5-8(7-18)6-11(17-10)16-9-1-3-12(14,15)4-2-9/h5-6,9,18H,1-4,7H2,(H,16,17) |
| InChIKey | JYQDKFPGTUOQHV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.71 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol?
The IUPAC name of [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol (CID 139300333) is [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol.
What is the SMILES notation for [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol?
The canonical SMILES for [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol is OCc1cc(Cl)nc(NC2CCC(F)(F)CC2)c1.
What is the InChIKey of [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol?
The InChIKey is JYQDKFPGTUOQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClF2N2O/c13-10-5-8(7-18)6-11(17-10)16-9-1-3-12(14,15)4-2-9/h5-6,9,18H,1-4,7H2,(H,16,17).
What are the key properties of [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol?
[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol has a molecular weight of 276.71 g/mol, XLogP of 3.22, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methanol is sourced from PubChem (CID 139300333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).