About 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone
1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone (PubChem CID 139300335) has the molecular formula C17H20F2N4O
and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone.
Molecular Properties
| Compound Name | 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone |
| PubChem CID | 139300335 |
| Molecular Formula | C17H20F2N4O |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone |
| SMILES | CC(=O)c1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(C)n2)c1 |
| InChI | InChI=1S/C17H20F2N4O/c1-11-5-8-23(22-11)16-10-13(12(2)24)9-15(21-16)20-14-3-6-17(18,19)7-4-14/h5,8-10,14H,3-4,6-7H2,1-2H3,(H,20,21) |
| InChIKey | FYXJQMWPXKXLQR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone?
The IUPAC name of 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone (CID 139300335) is 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone.
What is the SMILES notation for 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone?
The canonical SMILES for 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone is CC(=O)c1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(C)n2)c1.
What is the InChIKey of 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone?
The InChIKey is FYXJQMWPXKXLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N4O/c1-11-5-8-23(22-11)16-10-13(12(2)24)9-15(21-16)20-14-3-6-17(18,19)7-4-14/h5,8-10,14H,3-4,6-7H2,1-2H3,(H,20,21).
What are the key properties of 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone?
1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone has a molecular weight of 334.37 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4,4-difluorocyclohexyl)amino]-6-(3-methylpyrazol-1-yl)-4-pyridinyl]ethanone is sourced from PubChem (CID 139300335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).