About tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate
tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate (PubChem CID 139300350) has the molecular formula C20H29ClF2N4O2
and a molecular weight of 430.93 g/mol. Its IUPAC name is tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate |
| PubChem CID | 139300350 |
| Molecular Formula | C20H29ClF2N4O2 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(Cl)nc(NC3CCC(F)(F)CC3)n2)CC1 |
| InChI | InChI=1S/C20H29ClF2N4O2/c1-19(2,3)29-18(28)27-10-6-13(7-11-27)15-12-16(21)26-17(25-15)24-14-4-8-20(22,23)9-5-14/h12-14H,4-11H2,1-3H3,(H,24,25,26) |
| InChIKey | CGRKQGBSTXUEBI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate (CID 139300350) is tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(c2cc(Cl)nc(NC3CCC(F)(F)CC3)n2)CC1.
What is the InChIKey of tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate?
The InChIKey is CGRKQGBSTXUEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29ClF2N4O2/c1-19(2,3)29-18(28)27-10-6-13(7-11-27)15-12-16(21)26-17(25-15)24-14-4-8-20(22,23)9-5-14/h12-14H,4-11H2,1-3H3,(H,24,25,26).
What are the key properties of tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate?
tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate has a molecular weight of 430.93 g/mol, XLogP of 5.23, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[6-chloro-2-[(4,4-difluorocyclohexyl)amino]pyrimidin-4-yl]piperidine-1-carboxylate is sourced from PubChem (CID 139300350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).