About 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde
1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde (PubChem CID 139300376) has the molecular formula C15H17F2N5O
and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde |
| PubChem CID | 139300376 |
| Molecular Formula | C15H17F2N5O |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde |
| SMILES | Cc1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(C=O)n2)n1 |
| InChI | InChI=1S/C15H17F2N5O/c1-10-8-13(19-11-2-5-15(16,17)6-3-11)20-14(18-10)22-7-4-12(9-23)21-22/h4,7-9,11H,2-3,5-6H2,1H3,(H,18,19,20) |
| InChIKey | HEJPSXGDBCCZGZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde?
The IUPAC name of 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde (CID 139300376) is 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde.
What is the SMILES notation for 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde?
The canonical SMILES for 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde is Cc1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(C=O)n2)n1.
What is the InChIKey of 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde?
The InChIKey is HEJPSXGDBCCZGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N5O/c1-10-8-13(19-11-2-5-15(16,17)6-3-11)20-14(18-10)22-7-4-12(9-23)21-22/h4,7-9,11H,2-3,5-6H2,1H3,(H,18,19,20).
What are the key properties of 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde?
1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde has a molecular weight of 321.33 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]pyrazole-3-carbaldehyde is sourced from PubChem (CID 139300376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).