C19H25F2N5O — CID 139300507
N-(4,4-difluorocyclohexyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(1-ethoxyethenyl)pyrimidin-4-amine (PubChem CID 139300507) has the molecular formula C19H25F2N5O and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(1-ethoxyethenyl)pyrimidin-4-amine.
| Compound Name | N-(4,4-difluorocyclohexyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(1-ethoxyethenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 139300507 |
| Molecular Formula | C19H25F2N5O |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2-(3,5-dimethylpyrazol-1-yl)-6-(1-ethoxyethenyl)pyrimidin-4-amine |
| SMILES | C=C(OCC)c1cc(NC2CCC(F)(F)CC2)nc(-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C19H25F2N5O/c1-5-27-14(4)16-11-17(22-15-6-8-19(20,21)9-7-15)24-18(23-16)26-13(3)10-12(2)25-26/h10-11,15H,4-9H2,1-3H3,(H,22,23,24) |
| InChIKey | CQDGPMSMWFQEAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|