About 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine
6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine (PubChem CID 139300550) has the molecular formula C14H13ClF5N5
and a molecular weight of 381.74 g/mol. Its IUPAC name is 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine |
| PubChem CID | 139300550 |
| Molecular Formula | C14H13ClF5N5 |
| Molecular Weight | 381.74 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine |
| SMILES | FC1(F)CCC(Nc2cc(Cl)nc(-n3ccc(C(F)(F)F)n3)n2)CC1 |
| InChI | InChI=1S/C14H13ClF5N5/c15-10-7-11(21-8-1-4-13(16,17)5-2-8)23-12(22-10)25-6-3-9(24-25)14(18,19)20/h3,6-8H,1-2,4-5H2,(H,21,22,23) |
| InChIKey | RIIJLFZWKNEOEW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.74 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine?
The IUPAC name of 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine (CID 139300550) is 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine.
What is the SMILES notation for 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine?
The canonical SMILES for 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine is FC1(F)CCC(Nc2cc(Cl)nc(-n3ccc(C(F)(F)F)n3)n2)CC1.
What is the InChIKey of 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine?
The InChIKey is RIIJLFZWKNEOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClF5N5/c15-10-7-11(21-8-1-4-13(16,17)5-2-8)23-12(22-10)25-6-3-9(24-25)14(18,19)20/h3,6-8H,1-2,4-5H2,(H,21,22,23).
What are the key properties of 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine?
6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine has a molecular weight of 381.74 g/mol, XLogP of 4.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(4,4-difluorocyclohexyl)-2-[3-(trifluoromethyl)pyrazol-1-yl]pyrimidin-4-amine is sourced from PubChem (CID 139300550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).