About N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide
N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide (PubChem CID 139300567) has the molecular formula C14H18ClF2N3O
and a molecular weight of 317.77 g/mol. Its IUPAC name is N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide |
| PubChem CID | 139300567 |
| Molecular Formula | C14H18ClF2N3O |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cc(Cl)nc(NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C14H18ClF2N3O/c1-9(21)18-8-10-6-12(15)20-13(7-10)19-11-2-4-14(16,17)5-3-11/h6-7,11H,2-5,8H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | SLKTWJWRFBMZGC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide?
The IUPAC name of N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide (CID 139300567) is N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide.
What is the SMILES notation for N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide?
The canonical SMILES for N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide is CC(=O)NCc1cc(Cl)nc(NC2CCC(F)(F)CC2)c1.
What is the InChIKey of N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide?
The InChIKey is SLKTWJWRFBMZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClF2N3O/c1-9(21)18-8-10-6-12(15)20-13(7-10)19-11-2-4-14(16,17)5-3-11/h6-7,11H,2-5,8H2,1H3,(H,18,21)(H,19,20).
What are the key properties of N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide?
N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide has a molecular weight of 317.77 g/mol, XLogP of 3.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-chloro-6-[(4,4-difluorocyclohexyl)amino]-4-pyridinyl]methyl]acetamide is sourced from PubChem (CID 139300567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).