C18H21F2N5O2 — CID 139300568
N-[[2-[(4,4-difluorocyclohexyl)amino]-6-(3-formylpyrazol-1-yl)-4-pyridinyl]methyl]acetamide (PubChem CID 139300568) has the molecular formula C18H21F2N5O2 and a molecular weight of 377.40 g/mol. Its IUPAC name is N-[[2-[(4,4-difluorocyclohexyl)amino]-6-(3-formylpyrazol-1-yl)-4-pyridinyl]methyl]acetamide.
| Compound Name | N-[[2-[(4,4-difluorocyclohexyl)amino]-6-(3-formylpyrazol-1-yl)-4-pyridinyl]methyl]acetamide |
|---|---|
| PubChem CID | 139300568 |
| Molecular Formula | C18H21F2N5O2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[[2-[(4,4-difluorocyclohexyl)amino]-6-(3-formylpyrazol-1-yl)-4-pyridinyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(C=O)n2)c1 |
| InChI | InChI=1S/C18H21F2N5O2/c1-12(27)21-10-13-8-16(22-14-2-5-18(19,20)6-3-14)23-17(9-13)25-7-4-15(11-26)24-25/h4,7-9,11,14H,2-3,5-6,10H2,1H3,(H,21,27)(H,22,23) |
| InChIKey | PAWKWFGJJYBGSF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|