About N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine
N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine (PubChem CID 139300579) has the molecular formula C18H23F2N5O
and a molecular weight of 363.41 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine |
| PubChem CID | 139300579 |
| Molecular Formula | C18H23F2N5O |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine |
| SMILES | C=C(OCC)c1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(C)n2)n1 |
| InChI | InChI=1S/C18H23F2N5O/c1-4-26-13(3)15-11-16(21-14-5-8-18(19,20)9-6-14)23-17(22-15)25-10-7-12(2)24-25/h7,10-11,14H,3-6,8-9H2,1-2H3,(H,21,22,23) |
| InChIKey | BPFMKPILEXDHTB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine?
The IUPAC name of N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine (CID 139300579) is N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine.
What is the SMILES notation for N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine?
The canonical SMILES for N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine is C=C(OCC)c1cc(NC2CCC(F)(F)CC2)nc(-n2ccc(C)n2)n1.
What is the InChIKey of N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine?
The InChIKey is BPFMKPILEXDHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23F2N5O/c1-4-26-13(3)15-11-16(21-14-5-8-18(19,20)9-6-14)23-17(22-15)25-10-7-12(2)24-25/h7,10-11,14H,3-6,8-9H2,1-2H3,(H,21,22,23).
What are the key properties of N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine?
N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine has a molecular weight of 363.41 g/mol, XLogP of 3.97, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-difluorocyclohexyl)-6-(1-ethoxyethenyl)-2-(3-methylpyrazol-1-yl)pyrimidin-4-amine is sourced from PubChem (CID 139300579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).