C13H14ClF2N5 — CID 139300624
6-chloro-N-(4,4-difluorocyclohexyl)-2-pyrazol-1-ylpyrimidin-4-amine (PubChem CID 139300624) has the molecular formula C13H14ClF2N5 and a molecular weight of 313.74 g/mol. Its IUPAC name is 6-chloro-N-(4,4-difluorocyclohexyl)-2-pyrazol-1-ylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(4,4-difluorocyclohexyl)-2-pyrazol-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 139300624 |
| Molecular Formula | C13H14ClF2N5 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 6-chloro-N-(4,4-difluorocyclohexyl)-2-pyrazol-1-ylpyrimidin-4-amine |
| SMILES | FC1(F)CCC(Nc2cc(Cl)nc(-n3cccn3)n2)CC1 |
| InChI | InChI=1S/C13H14ClF2N5/c14-10-8-11(18-9-2-4-13(15,16)5-3-9)20-12(19-10)21-7-1-6-17-21/h1,6-9H,2-5H2,(H,18,19,20) |
| InChIKey | CGGITUNHMWZCQF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |